C26H30N2O — CID 58266243
(10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58266243) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58266243 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)CC1=CCC1C2CC[C@]2(C)C(n3cnc4ccccc43)=CCC12 |
| InChI | InChI=1S/C26H30N2O/c1-25-13-11-18(29)15-17(25)7-8-19-20-9-10-24(26(20,2)14-12-21(19)25)28-16-27-22-5-3-4-6-23(22)28/h3-7,10,16,19-21H,8-9,11-15H2,1-2H3/t19?,20?,21?,25-,26-/m0/s1 |
| InChIKey | ZPNBRAFUNDHVQC-OSTLVTSRSA-N |
| XLogP | 6.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|