C23H21F3N5O5S+ — CID 58266280
4-[7-(2-hydroxyethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-pyrimido[4,5-d]pyridazin-7-ium-4-yl]-3-methylsulfonylbenzonitrile (PubChem CID 58266280) has the molecular formula C23H21F3N5O5S+ and a molecular weight of 536.51 g/mol. Its IUPAC name is 4-[7-(2-hydroxyethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-pyrimido[4,5-d]pyridazin-7-ium-4-yl]-3-methylsulfonylbenzonitrile.
| Compound Name | 4-[7-(2-hydroxyethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-pyrimido[4,5-d]pyridazin-7-ium-4-yl]-3-methylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 58266280 |
| Molecular Formula | C23H21F3N5O5S+ |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 4-[7-(2-hydroxyethyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-pyrimido[4,5-d]pyridazin-7-ium-4-yl]-3-methylsulfonylbenzonitrile |
| SMILES | CS(=O)(=O)c1cc(C#N)ccc1C1NC(=O)N(c2cccc(C(F)(F)F)c2)C2=C1C(=O)N[NH+](CCO)C2 |
| InChI | InChI=1S/C23H20F3N5O5S/c1-37(35,36)18-9-13(11-27)5-6-16(18)20-19-17(12-30(7-8-32)29-21(19)33)31(22(34)28-20)15-4-2-3-14(10-15)23(24,25)26/h2-6,9-10,20,32H,7-8,12H2,1H3,(H,28,34)(H,29,33)/p+1 |
| InChIKey | QCPYQXRBGDVHMN-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |