C23H22N6O — CID 58266344
3-(1-ethylpiperidin-4-yl)oxy-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266344) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)oxy-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(1-ethylpiperidin-4-yl)oxy-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266344 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)oxy-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCC(Oc2c(C#N)ncc3[nH]c4ncc(-c5ccncc5)cc4c23)CC1 |
| InChI | InChI=1S/C23H22N6O/c1-2-29-9-5-17(6-10-29)30-22-19(12-24)26-14-20-21(22)18-11-16(13-27-23(18)28-20)15-3-7-25-8-4-15/h3-4,7-8,11,13-14,17H,2,5-6,9-10H2,1H3,(H,27,28) |
| InChIKey | IXHQETUIRLSTAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |