C25H28N4O4SSi — CID 58266353
[4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]phenyl]methyl methanesulfonate (PubChem CID 58266353) has the molecular formula C25H28N4O4SSi and a molecular weight of 508.68 g/mol. Its IUPAC name is [4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 58266353 |
| Molecular Formula | C25H28N4O4SSi |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | [4-[4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]phenyl]methyl methanesulfonate |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(C#N)cc2c2cc(-c3ccc(COS(C)(=O)=O)cc3)cnc21 |
| InChI | InChI=1S/C25H28N4O4SSi/c1-34(30,31)33-16-18-5-7-19(8-6-18)20-11-23-22-12-21(13-26)27-15-24(22)29(25(23)28-14-20)17-32-9-10-35(2,3)4/h5-8,11-12,14-15H,9-10,16-17H2,1-4H3 |
| InChIKey | OCWOYWRMHKTYLT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 107.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|