C23H23N5O — CID 58266373
12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide (PubChem CID 58266373) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide.
| Compound Name | 12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 58266373 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
| SMILES | NC(=O)c1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCCCC4)cc3)cc12 |
| InChI | InChI=1S/C23H23N5O/c24-22(29)20-11-18-19-10-17(12-26-23(19)27-21(18)13-25-20)16-6-4-15(5-7-16)14-28-8-2-1-3-9-28/h4-7,10-13H,1-3,8-9,14H2,(H2,24,29)(H,26,27) |
| InChIKey | CJNHSOPFLMXKDT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |