C29H29F2N5O — CID 58266381
3-cyclohexyloxy-12-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266381) has the molecular formula C29H29F2N5O and a molecular weight of 501.58 g/mol. Its IUPAC name is 3-cyclohexyloxy-12-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-cyclohexyloxy-12-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266381 |
| Molecular Formula | C29H29F2N5O |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 3-cyclohexyloxy-12-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1ncc2[nH]c3ncc(-c4ccc(CN5CCC(F)(F)CC5)cc4)cc3c2c1OC1CCCCC1 |
| InChI | InChI=1S/C29H29F2N5O/c30-29(31)10-12-36(13-11-29)18-19-6-8-20(9-7-19)21-14-23-26-25(35-28(23)34-16-21)17-33-24(15-32)27(26)37-22-4-2-1-3-5-22/h6-9,14,16-17,22H,1-5,10-13,18H2,(H,34,35) |
| InChIKey | JRTDDRGXCPMVAG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |