C24H20N6 — CID 58266398
12-[4-[(4-cyanopiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266398) has the molecular formula C24H20N6 and a molecular weight of 392.47 g/mol. Its IUPAC name is 12-[4-[(4-cyanopiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-[(4-cyanopiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266398 |
| Molecular Formula | C24H20N6 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 12-[4-[(4-cyanopiperidin-1-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCC(C#N)CC4)cc3)cc12 |
| InChI | InChI=1S/C24H20N6/c25-11-16-5-7-30(8-6-16)15-17-1-3-18(4-2-17)19-9-22-21-10-20(12-26)27-14-23(21)29-24(22)28-13-19/h1-4,9-10,13-14,16H,5-8,15H2,(H,28,29) |
| InChIKey | JSXCSUSMRGBMGM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |