C22H22N6O — CID 58266437
12-[4-(4-methylpiperazin-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide (PubChem CID 58266437) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 12-[4-(4-methylpiperazin-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide.
| Compound Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 58266437 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]c5cnc(C(N)=O)cc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C22H22N6O/c1-27-6-8-28(9-7-27)16-4-2-14(3-5-16)15-10-18-17-11-19(21(23)29)24-13-20(17)26-22(18)25-12-15/h2-5,10-13H,6-9H2,1H3,(H2,23,29)(H,25,26) |
| InChIKey | JAPRUHQEXJGMCA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |