C23H21N5O — CID 58266453
12-[4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266453) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 12-[4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266453 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 12-[4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCC[C@@H](O)C4)cc3)cc12 |
| InChI | InChI=1S/C23H21N5O/c24-10-18-9-20-21-8-17(11-26-23(21)27-22(20)12-25-18)16-5-3-15(4-6-16)13-28-7-1-2-19(29)14-28/h3-6,8-9,11-12,19,29H,1-2,7,13-14H2,(H,26,27)/t19-/m1/s1 |
| InChIKey | IXIKZBWGIPPSBJ-LJQANCHMSA-N |
| XLogP | 3.61 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |