C21H23BrN6OSi — CID 58266535
3-bromo-12-(1-methylpyrazol-4-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266535) has the molecular formula C21H23BrN6OSi and a molecular weight of 483.45 g/mol. Its IUPAC name is 3-bromo-12-(1-methylpyrazol-4-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-bromo-12-(1-methylpyrazol-4-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266535 |
| Molecular Formula | C21H23BrN6OSi |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 3-bromo-12-(1-methylpyrazol-4-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | Cn1cc(-c2cnc3c(c2)c2c(Br)c(C#N)ncc2n3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C21H23BrN6OSi/c1-27-12-15(10-26-27)14-7-16-19-18(11-24-17(8-23)20(19)22)28(21(16)25-9-14)13-29-5-6-30(2,3)4/h7,9-12H,5-6,13H2,1-4H3 |
| InChIKey | IXMBJGDLHXDAGV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|