C25H27N5O — CID 58266536
N-ethyl-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide (PubChem CID 58266536) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is N-ethyl-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide.
| Compound Name | N-ethyl-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 58266536 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-ethyl-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
| SMILES | CCNC(=O)c1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCCCC4)cc3)cc12 |
| InChI | InChI=1S/C25H27N5O/c1-2-26-25(31)22-13-20-21-12-19(14-28-24(21)29-23(20)15-27-22)18-8-6-17(7-9-18)16-30-10-4-3-5-11-30/h6-9,12-15H,2-5,10-11,16H2,1H3,(H,26,31)(H,28,29) |
| InChIKey | YKQWVJVJXZIDGO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |