C31H37N5OSi — CID 58266550
12-[4-(8-azabicyclo[3.2.1]octan-8-ylmethyl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266550) has the molecular formula C31H37N5OSi and a molecular weight of 523.76 g/mol. Its IUPAC name is 12-[4-(8-azabicyclo[3.2.1]octan-8-ylmethyl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-(8-azabicyclo[3.2.1]octan-8-ylmethyl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266550 |
| Molecular Formula | C31H37N5OSi |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 12-[4-(8-azabicyclo[3.2.1]octan-8-ylmethyl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(C#N)cc2c2cc(-c3ccc(CN4C5CCCC4CC5)cc3)cnc21 |
| InChI | InChI=1S/C31H37N5OSi/c1-38(2,3)14-13-37-21-36-30-19-33-25(17-32)16-28(30)29-15-24(18-34-31(29)36)23-9-7-22(8-10-23)20-35-26-5-4-6-27(35)12-11-26/h7-10,15-16,18-19,26-27H,4-6,11-14,20-21H2,1-3H3 |
| InChIKey | GSOGDYPWXNGVJT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|