C18H12N4O — CID 58266556
12-(3-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266556) has the molecular formula C18H12N4O and a molecular weight of 300.32 g/mol. Its IUPAC name is 12-(3-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(3-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266556 |
| Molecular Formula | C18H12N4O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 12-(3-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | COc1cccc(-c2cnc3[nH]c4cnc(C#N)cc4c3c2)c1 |
| InChI | InChI=1S/C18H12N4O/c1-23-14-4-2-3-11(5-14)12-6-16-15-7-13(8-19)20-10-17(15)22-18(16)21-9-12/h2-7,9-10H,1H3,(H,21,22) |
| InChIKey | FFMNEXZPZFLTSI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |