C18H19BrN6O2S — CID 58266561
12-bromo-3-[4-(2-methylsulfonylethyl)piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266561) has the molecular formula C18H19BrN6O2S and a molecular weight of 463.36 g/mol. Its IUPAC name is 12-bromo-3-[4-(2-methylsulfonylethyl)piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-bromo-3-[4-(2-methylsulfonylethyl)piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266561 |
| Molecular Formula | C18H19BrN6O2S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 12-bromo-3-[4-(2-methylsulfonylethyl)piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CS(=O)(=O)CCN1CCN(c2c(C#N)ncc3[nH]c4ncc(Br)cc4c23)CC1 |
| InChI | InChI=1S/C18H19BrN6O2S/c1-28(26,27)7-6-24-2-4-25(5-3-24)17-14(9-20)21-11-15-16(17)13-8-12(19)10-22-18(13)23-15/h8,10-11H,2-7H2,1H3,(H,22,23) |
| InChIKey | YLFGXJIDCLRCTB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |