C24H22FN5O — CID 58266601
3-(1-ethylpiperidin-4-yl)oxy-12-(3-fluorophenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266601) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)oxy-12-(3-fluorophenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(1-ethylpiperidin-4-yl)oxy-12-(3-fluorophenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266601 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)oxy-12-(3-fluorophenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCC(Oc2c(C#N)ncc3[nH]c4ncc(-c5cccc(F)c5)cc4c23)CC1 |
| InChI | InChI=1S/C24H22FN5O/c1-2-30-8-6-18(7-9-30)31-23-20(12-26)27-14-21-22(23)19-11-16(13-28-24(19)29-21)15-4-3-5-17(25)10-15/h3-5,10-11,13-14,18H,2,6-9H2,1H3,(H,28,29) |
| InChIKey | TYLRJQNPMOCNBN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |