C24H23N5O — CID 58266612
3-(1-ethylpiperidin-4-yl)oxy-12-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266612) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)oxy-12-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(1-ethylpiperidin-4-yl)oxy-12-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266612 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)oxy-12-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCC(Oc2c(C#N)ncc3[nH]c4ncc(-c5ccccc5)cc4c23)CC1 |
| InChI | InChI=1S/C24H23N5O/c1-2-29-10-8-18(9-11-29)30-23-20(13-25)26-15-21-22(23)19-12-17(14-27-24(19)28-21)16-6-4-3-5-7-16/h3-7,12,14-15,18H,2,8-11H2,1H3,(H,27,28) |
| InChIKey | AKTGYJCVQOVQFT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |