C17H9FN4O — CID 58266635
12-(5-fluoro-2-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266635) has the molecular formula C17H9FN4O and a molecular weight of 304.28 g/mol. Its IUPAC name is 12-(5-fluoro-2-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(5-fluoro-2-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266635 |
| Molecular Formula | C17H9FN4O |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 12-(5-fluoro-2-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3cc(F)ccc3O)cc12 |
| InChI | InChI=1S/C17H9FN4O/c18-10-1-2-16(23)12(4-10)9-3-14-13-5-11(6-19)20-8-15(13)22-17(14)21-7-9/h1-5,7-8,23H,(H,21,22) |
| InChIKey | NGWKARYMJNKKNN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |