C15H8N4S — CID 58266657
12-thiophen-2-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266657) has the molecular formula C15H8N4S and a molecular weight of 276.32 g/mol. Its IUPAC name is 12-thiophen-2-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-thiophen-2-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266657 |
| Molecular Formula | C15H8N4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 12-thiophen-2-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3cccs3)cc12 |
| InChI | InChI=1S/C15H8N4S/c16-6-10-5-11-12-4-9(14-2-1-3-20-14)7-18-15(12)19-13(11)8-17-10/h1-5,7-8H,(H,18,19) |
| InChIKey | ZIPOVAOQUWRKDQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |