C23H24N4O — CID 58266664
[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]methanol (PubChem CID 58266664) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is [12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]methanol.
| Compound Name | [12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]methanol |
|---|---|
| PubChem CID | 58266664 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]methanol |
| SMILES | OCc1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCCCC4)cc3)cc12 |
| InChI | InChI=1S/C23H24N4O/c28-15-19-11-20-21-10-18(12-25-23(21)26-22(20)13-24-19)17-6-4-16(5-7-17)14-27-8-2-1-3-9-27/h4-7,10-13,28H,1-3,8-9,14-15H2,(H,25,26) |
| InChIKey | MUWHBCPTIZWOPV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |