C25H27N5OSi — CID 58266687
12-(2,3-dihydroindol-1-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266687) has the molecular formula C25H27N5OSi and a molecular weight of 441.61 g/mol. Its IUPAC name is 12-(2,3-dihydroindol-1-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(2,3-dihydroindol-1-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266687 |
| Molecular Formula | C25H27N5OSi |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 12-(2,3-dihydroindol-1-yl)-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c2cnc(C#N)cc2c2cc(N3CCc4ccccc43)cnc21 |
| InChI | InChI=1S/C25H27N5OSi/c1-32(2,3)11-10-31-17-30-24-16-27-19(14-26)12-21(24)22-13-20(15-28-25(22)30)29-9-8-18-6-4-5-7-23(18)29/h4-7,12-13,15-16H,8-11,17H2,1-3H3 |
| InChIKey | CSSPNQNNMFDNKO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|