C12H8N4O — CID 58266690
4-isocyano-8-methyl-10-oxido-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58266690) has the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-isocyano-8-methyl-10-oxido-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-isocyano-8-methyl-10-oxido-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58266690 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-isocyano-8-methyl-10-oxido-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | [C-]#[N+]c1cc2c3ccc[n+]([O-])c3n(C)c2cn1 |
| InChI | InChI=1S/C12H8N4O/c1-13-11-6-9-8-4-3-5-16(17)12(8)15(2)10(9)7-14-11/h3-7H,2H3 |
| InChIKey | GPKUIXQMTANPEA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|