C10H7ClN3P — CID 58266722
(4-chloro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)phosphane (PubChem CID 58266722) has the molecular formula C10H7ClN3P and a molecular weight of 235.61 g/mol. Its IUPAC name is (4-chloro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)phosphane.
| Compound Name | (4-chloro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)phosphane |
|---|---|
| PubChem CID | 58266722 |
| Molecular Formula | C10H7ClN3P |
| Molecular Weight | 235.61 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | (4-chloro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)phosphane |
| SMILES | Pn1c2cnc(Cl)cc2c2cccnc21 |
| InChI | InChI=1S/C10H7ClN3P/c11-9-4-7-6-2-1-3-12-10(6)14(15)8(7)5-13-9/h1-5H,15H2 |
| InChIKey | IFVVUZGNALWQTO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|