C23H23BrN4O — CID 58266765
4-bromo-12-[3-methoxy-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58266765) has the molecular formula C23H23BrN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is 4-bromo-12-[3-methoxy-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-bromo-12-[3-methoxy-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58266765 |
| Molecular Formula | C23H23BrN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-bromo-12-[3-methoxy-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | COc1cc(-c2cnc3[nH]c4cnc(Br)cc4c3c2)ccc1CN1CCCCC1 |
| InChI | InChI=1S/C23H23BrN4O/c1-29-21-10-15(5-6-16(21)14-28-7-3-2-4-8-28)17-9-19-18-11-22(24)25-13-20(18)27-23(19)26-12-17/h5-6,9-13H,2-4,7-8,14H2,1H3,(H,26,27) |
| InChIKey | CLBHWTOBUFDHRP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|