C17H12N4O2 — CID 58266793
12-(4-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide (PubChem CID 58266793) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 12-(4-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide.
| Compound Name | 12-(4-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 58266793 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 12-(4-hydroxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxamide |
| SMILES | NC(=O)c1cc2c(cn1)[nH]c1ncc(-c3ccc(O)cc3)cc12 |
| InChI | InChI=1S/C17H12N4O2/c18-16(23)14-6-12-13-5-10(9-1-3-11(22)4-2-9)7-20-17(13)21-15(12)8-19-14/h1-8,22H,(H2,18,23)(H,20,21) |
| InChIKey | OWCMYXUABBAFHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |