C30H37N5OSi — CID 58266844
12-[4-(1-ethylpiperidin-2-yl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266844) has the molecular formula C30H37N5OSi and a molecular weight of 511.75 g/mol. Its IUPAC name is 12-[4-(1-ethylpiperidin-2-yl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-(1-ethylpiperidin-2-yl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266844 |
| Molecular Formula | C30H37N5OSi |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | 12-[4-(1-ethylpiperidin-2-yl)phenyl]-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCCCC1c1ccc(-c2cnc3c(c2)c2cc(C#N)ncc2n3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C30H37N5OSi/c1-5-34-13-7-6-8-28(34)23-11-9-22(10-12-23)24-16-27-26-17-25(18-31)32-20-29(26)35(30(27)33-19-24)21-36-14-15-37(2,3)4/h9-12,16-17,19-20,28H,5-8,13-15,21H2,1-4H3 |
| InChIKey | GPEHLIRLOKUNFU-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|