About 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene
4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene (PubChem CID 58266970) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene.
Molecular Properties
| Compound Name | 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
| PubChem CID | 58266970 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
| SMILES | Cc1nc2c(s1)C1CCC2CC1 |
| InChI | InChI=1S/C10H13NS/c1-6-11-9-7-2-4-8(5-3-7)10(9)12-6/h7-8H,2-5H2,1H3 |
| InChIKey | KQZMQMMNZYQOOV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The IUPAC name of 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene (CID 58266970) is 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene.
What is the SMILES notation for 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The canonical SMILES for 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene is Cc1nc2c(s1)C1CCC2CC1.
What is the InChIKey of 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The InChIKey is KQZMQMMNZYQOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-6-11-9-7-2-4-8(5-3-7)10(9)12-6/h7-8H,2-5H2,1H3.
What are the key properties of 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene has a molecular weight of 179.29 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-thia-5-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene is sourced from PubChem (CID 58266970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).