C26H25NO2 — CID 58267108
4-(1-benzofuran-5-yl)-4-methyl-1-[4-(2-methyl-4-pyridinyl)phenyl]pentan-2-one (PubChem CID 58267108) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-(1-benzofuran-5-yl)-4-methyl-1-[4-(2-methyl-4-pyridinyl)phenyl]pentan-2-one.
| Compound Name | 4-(1-benzofuran-5-yl)-4-methyl-1-[4-(2-methyl-4-pyridinyl)phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58267108 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 4-(1-benzofuran-5-yl)-4-methyl-1-[4-(2-methyl-4-pyridinyl)phenyl]pentan-2-one |
| SMILES | Cc1cc(-c2ccc(CC(=O)CC(C)(C)c3ccc4occc4c3)cc2)ccn1 |
| InChI | InChI=1S/C26H25NO2/c1-18-14-21(10-12-27-18)20-6-4-19(5-7-20)15-24(28)17-26(2,3)23-8-9-25-22(16-23)11-13-29-25/h4-14,16H,15,17H2,1-3H3 |
| InChIKey | TYFPYMSBPAGWHJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |