C16H14F3N5OS2 — CID 58267274
N-(1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 58267274) has the molecular formula C16H14F3N5OS2 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58267274 |
| Molecular Formula | C16H14F3N5OS2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1csc(Cn2nc(C(F)(F)F)c3c2CCCC3)n1 |
| InChI | InChI=1S/C16H14F3N5OS2/c17-16(18,19)13-9-3-1-2-4-11(9)24(23-13)7-12-21-10(8-27-12)14(25)22-15-20-5-6-26-15/h5-6,8H,1-4,7H2,(H,20,22,25) |
| InChIKey | WRNDIBCYDXECQM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |