C21H18F3N5O2S — CID 58267428
N-(3-oxo-1,2-dihydroisoindol-4-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 58267428) has the molecular formula C21H18F3N5O2S and a molecular weight of 461.47 g/mol. Its IUPAC name is N-(3-oxo-1,2-dihydroisoindol-4-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-oxo-1,2-dihydroisoindol-4-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58267428 |
| Molecular Formula | C21H18F3N5O2S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-(3-oxo-1,2-dihydroisoindol-4-yl)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)NC2)c1csc(Cn2nc(C(F)(F)F)c3c2CCCC3)n1 |
| InChI | InChI=1S/C21H18F3N5O2S/c22-21(23,24)18-12-5-1-2-7-15(12)29(28-18)9-16-26-14(10-32-16)19(30)27-13-6-3-4-11-8-25-20(31)17(11)13/h3-4,6,10H,1-2,5,7-9H2,(H,25,31)(H,27,30) |
| InChIKey | JPKZDDMSXHSWBI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |