C18H23F3N4O — CID 58267475
1-(1-methylpyrazol-3-yl)-6-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]hexan-2-one (PubChem CID 58267475) has the molecular formula C18H23F3N4O and a molecular weight of 368.40 g/mol. Its IUPAC name is 1-(1-methylpyrazol-3-yl)-6-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]hexan-2-one.
| Compound Name | 1-(1-methylpyrazol-3-yl)-6-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]hexan-2-one |
|---|---|
| PubChem CID | 58267475 |
| Molecular Formula | C18H23F3N4O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-(1-methylpyrazol-3-yl)-6-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]hexan-2-one |
| SMILES | Cn1ccc(CC(=O)CCCCn2nc(C(F)(F)F)c3c2CCCC3)n1 |
| InChI | InChI=1S/C18H23F3N4O/c1-24-11-9-13(22-24)12-14(26)6-4-5-10-25-16-8-3-2-7-15(16)17(23-25)18(19,20)21/h9,11H,2-8,10,12H2,1H3 |
| InChIKey | DUXRCDUTOAFCJX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|