C19H20F3N5O — CID 58267538
N,N-dimethyl-4-[5-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 58267538) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 58267538 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N,N-dimethyl-4-[5-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | CN(C)c1ccc(-c2noc(Cn3nc(C(F)(F)F)c4c3CCCC4)n2)cc1 |
| InChI | InChI=1S/C19H20F3N5O/c1-26(2)13-9-7-12(8-10-13)18-23-16(28-25-18)11-27-15-6-4-3-5-14(15)17(24-27)19(20,21)22/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | CGLWYXRGILDGOE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |