C24H26FN7OS — CID 58268563
2-fluoro-1'-[[3-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]pyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 58268563) has the molecular formula C24H26FN7OS and a molecular weight of 479.59 g/mol. Its IUPAC name is 2-fluoro-1'-[[3-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]pyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | 2-fluoro-1'-[[3-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]pyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 58268563 |
| Molecular Formula | C24H26FN7OS |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-fluoro-1'-[[3-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]pyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | Cc1nn(-c2ncccc2Cn2cncn2)cc1CN1CCC2(CC1)OCCc1cc(F)sc12 |
| InChI | InChI=1S/C24H26FN7OS/c1-17-20(14-32(29-17)23-19(3-2-7-27-23)13-31-16-26-15-28-31)12-30-8-5-24(6-9-30)22-18(4-10-33-24)11-21(25)34-22/h2-3,7,11,14-16H,4-6,8-10,12-13H2,1H3 |
| InChIKey | CPJVHRTZDRBMGS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |