About 4-tert-butyl-1,2,5-trimethylpyrazol-3-one
4-tert-butyl-1,2,5-trimethylpyrazol-3-one (PubChem CID 58268781) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-tert-butyl-1,2,5-trimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-tert-butyl-1,2,5-trimethylpyrazol-3-one |
| PubChem CID | 58268781 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 4-tert-butyl-1,2,5-trimethylpyrazol-3-one |
| SMILES | Cc1c(C(C)(C)C)c(=O)n(C)n1C |
| InChI | InChI=1S/C10H18N2O/c1-7-8(10(2,3)4)9(13)12(6)11(7)5/h1-6H3 |
| InChIKey | MEWBAVQRGFAOCV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-1,2,5-trimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2,5-trimethylpyrazol-3-one?
The IUPAC name of 4-tert-butyl-1,2,5-trimethylpyrazol-3-one (CID 58268781) is 4-tert-butyl-1,2,5-trimethylpyrazol-3-one.
What is the SMILES notation for 4-tert-butyl-1,2,5-trimethylpyrazol-3-one?
The canonical SMILES for 4-tert-butyl-1,2,5-trimethylpyrazol-3-one is Cc1c(C(C)(C)C)c(=O)n(C)n1C.
What is the InChIKey of 4-tert-butyl-1,2,5-trimethylpyrazol-3-one?
The InChIKey is MEWBAVQRGFAOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-7-8(10(2,3)4)9(13)12(6)11(7)5/h1-6H3.
What are the key properties of 4-tert-butyl-1,2,5-trimethylpyrazol-3-one?
4-tert-butyl-1,2,5-trimethylpyrazol-3-one has a molecular weight of 182.27 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2,5-trimethylpyrazol-3-one is sourced from PubChem (CID 58268781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).