C9H12N2O4 — CID 58268866
2,2-dimethyl-5-[2-(methylhydrazinylidene)ethylidene]-1,3-dioxane-4,6-dione (PubChem CID 58268866) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2,2-dimethyl-5-[2-(methylhydrazinylidene)ethylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[2-(methylhydrazinylidene)ethylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 58268866 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,2-dimethyl-5-[2-(methylhydrazinylidene)ethylidene]-1,3-dioxane-4,6-dione |
| SMILES | CNN=CC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C9H12N2O4/c1-9(2)14-7(12)6(8(13)15-9)4-5-11-10-3/h4-5,10H,1-3H3 |
| InChIKey | DETWRPJGZRPQTH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|