C23H22F2N6O2 — CID 58268942
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-prop-2-enoxyethoxy)-6-pyrazolo[1,5-a]pyrimidin-3-ylpyrimidin-4-amine (PubChem CID 58268942) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-prop-2-enoxyethoxy)-6-pyrazolo[1,5-a]pyrimidin-3-ylpyrimidin-4-amine.
| Compound Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-prop-2-enoxyethoxy)-6-pyrazolo[1,5-a]pyrimidin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 58268942 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-prop-2-enoxyethoxy)-6-pyrazolo[1,5-a]pyrimidin-3-ylpyrimidin-4-amine |
| SMILES | C=CCOCCOc1nc(N[C@@H](C)c2ccc(F)cc2F)cc(-c2cnn3cccnc23)n1 |
| InChI | InChI=1S/C23H22F2N6O2/c1-3-9-32-10-11-33-23-29-20(18-14-27-31-8-4-7-26-22(18)31)13-21(30-23)28-15(2)17-6-5-16(24)12-19(17)25/h3-8,12-15H,1,9-11H2,2H3,(H,28,29,30)/t15-/m0/s1 |
| InChIKey | PJECLBCXIKQVOR-HNNXBMFYSA-N |
| XLogP | 4.22 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|