C21H22FN7O2 — CID 58269000
3-[6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-2-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 58269000) has the molecular formula C21H22FN7O2 and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-[6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-2-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 3-[6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-2-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58269000 |
| Molecular Formula | C21H22FN7O2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-2-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COCCOc1nc(N[C@@H](C)c2ccc(F)cc2)cc(-c2c(N)nn3cccnc23)n1 |
| InChI | InChI=1S/C21H22FN7O2/c1-13(14-4-6-15(22)7-5-14)25-17-12-16(26-21(27-17)31-11-10-30-2)18-19(23)28-29-9-3-8-24-20(18)29/h3-9,12-13H,10-11H2,1-2H3,(H2,23,28)(H,25,26,27)/t13-/m0/s1 |
| InChIKey | ZZHPGYGWIJDNSV-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|