C24H26F3N5O2 — CID 58269602
4-[1-(1-amino-2,3-dihydroindene-1-carbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide (PubChem CID 58269602) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is 4-[1-(1-amino-2,3-dihydroindene-1-carbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[1-(1-amino-2,3-dihydroindene-1-carbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269602 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 4-[1-(1-amino-2,3-dihydroindene-1-carbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1ccc(C2CCN(C(=O)C3(N)CCc4ccccc43)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N5O2/c25-24(26,27)19-13-16(20(33)31-22(28)29)5-6-17(19)14-8-11-32(12-9-14)21(34)23(30)10-7-15-3-1-2-4-18(15)23/h1-6,13-14H,7-12,30H2,(H4,28,29,31,33) |
| InChIKey | RWEFIWRONZHZRJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|