About 4-isocyano-2,4,6-trimethylheptane
4-isocyano-2,4,6-trimethylheptane (PubChem CID 58269947) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 4-isocyano-2,4,6-trimethylheptane.
Molecular Properties
| Compound Name | 4-isocyano-2,4,6-trimethylheptane |
| PubChem CID | 58269947 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 4-isocyano-2,4,6-trimethylheptane |
| SMILES | [C-]#[N+]C(C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2)7-11(5,12-6)8-10(3)4/h9-10H,7-8H2,1-5H3 |
| InChIKey | NTIZIAYMEIXYFI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-2,4,6-trimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-2,4,6-trimethylheptane?
The IUPAC name of 4-isocyano-2,4,6-trimethylheptane (CID 58269947) is 4-isocyano-2,4,6-trimethylheptane.
What is the SMILES notation for 4-isocyano-2,4,6-trimethylheptane?
The canonical SMILES for 4-isocyano-2,4,6-trimethylheptane is [C-]#[N+]C(C)(CC(C)C)CC(C)C.
What is the InChIKey of 4-isocyano-2,4,6-trimethylheptane?
The InChIKey is NTIZIAYMEIXYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9(2)7-11(5,12-6)8-10(3)4/h9-10H,7-8H2,1-5H3.
What are the key properties of 4-isocyano-2,4,6-trimethylheptane?
4-isocyano-2,4,6-trimethylheptane has a molecular weight of 167.30 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-2,4,6-trimethylheptane is sourced from PubChem (CID 58269947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).