C22H28N2O4 — CID 58270415
(2S)-2-[5-[3-(1-hydroxycycloheptyl)propanoyl]-1-oxoisoquinolin-2-yl]propanamide (PubChem CID 58270415) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2S)-2-[5-[3-(1-hydroxycycloheptyl)propanoyl]-1-oxoisoquinolin-2-yl]propanamide.
| Compound Name | (2S)-2-[5-[3-(1-hydroxycycloheptyl)propanoyl]-1-oxoisoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 58270415 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2S)-2-[5-[3-(1-hydroxycycloheptyl)propanoyl]-1-oxoisoquinolin-2-yl]propanamide |
| SMILES | C[C@@H](C(N)=O)n1ccc2c(C(=O)CCC3(O)CCCCCC3)cccc2c1=O |
| InChI | InChI=1S/C22H28N2O4/c1-15(20(23)26)24-14-10-16-17(7-6-8-18(16)21(24)27)19(25)9-13-22(28)11-4-2-3-5-12-22/h6-8,10,14-15,28H,2-5,9,11-13H2,1H3,(H2,23,26)/t15-/m0/s1 |
| InChIKey | PUPKQZWAQGBTRT-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |