C12H9F5N4O — CID 58270477
N-(2,2,3,3,3-pentafluoropropyl)-1-pyridin-3-ylpyrazole-4-carboxamide (PubChem CID 58270477) has the molecular formula C12H9F5N4O and a molecular weight of 320.22 g/mol. Its IUPAC name is N-(2,2,3,3,3-pentafluoropropyl)-1-pyridin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-(2,2,3,3,3-pentafluoropropyl)-1-pyridin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58270477 |
| Molecular Formula | C12H9F5N4O |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(2,2,3,3,3-pentafluoropropyl)-1-pyridin-3-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)c1cnn(-c2cccnc2)c1 |
| InChI | InChI=1S/C12H9F5N4O/c13-11(14,12(15,16)17)7-19-10(22)8-4-20-21(6-8)9-2-1-3-18-5-9/h1-6H,7H2,(H,19,22) |
| InChIKey | ZENPPUYKIUKKEL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|