About (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate
(6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 58270778) has the molecular formula C21H22FN3O4
and a molecular weight of 399.42 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate |
| PubChem CID | 58270778 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCC(C(=O)NCC(=O)c3ccccc3F)CC2)cn1 |
| InChI | InChI=1S/C21H22FN3O4/c1-14-6-7-16(12-23-14)29-21(28)25-10-8-15(9-11-25)20(27)24-13-19(26)17-4-2-3-5-18(17)22/h2-7,12,15H,8-11,13H2,1H3,(H,24,27) |
| InChIKey | WLNHUPISIVLLAC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate?
The IUPAC name of (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate (CID 58270778) is (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate?
The canonical SMILES for (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate is Cc1ccc(OC(=O)N2CCC(C(=O)NCC(=O)c3ccccc3F)CC2)cn1.
What is the InChIKey of (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate?
The InChIKey is WLNHUPISIVLLAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O4/c1-14-6-7-16(12-23-14)29-21(28)25-10-8-15(9-11-25)20(27)24-13-19(26)17-4-2-3-5-18(17)22/h2-7,12,15H,8-11,13H2,1H3,(H,24,27).
What are the key properties of (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate?
(6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate has a molecular weight of 399.42 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) 4-[[2-(2-fluorophenyl)-2-oxoethyl]carbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 58270778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).