About (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate
(6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate (PubChem CID 58270794) has the molecular formula C20H20FN5O2
and a molecular weight of 381.41 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate |
| PubChem CID | 58270794 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCC(n3cnc(-c4ccc(F)cc4)n3)CC2)cn1 |
| InChI | InChI=1S/C20H20FN5O2/c1-14-2-7-18(12-22-14)28-20(27)25-10-8-17(9-11-25)26-13-23-19(24-26)15-3-5-16(21)6-4-15/h2-7,12-13,17H,8-11H2,1H3 |
| InChIKey | FJXFYPOWKTXOFE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate?
The IUPAC name of (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate (CID 58270794) is (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate.
What is the SMILES notation for (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate?
The canonical SMILES for (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate is Cc1ccc(OC(=O)N2CCC(n3cnc(-c4ccc(F)cc4)n3)CC2)cn1.
What is the InChIKey of (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate?
The InChIKey is FJXFYPOWKTXOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN5O2/c1-14-2-7-18(12-22-14)28-20(27)25-10-8-17(9-11-25)26-13-23-19(24-26)15-3-5-16(21)6-4-15/h2-7,12-13,17H,8-11H2,1H3.
What are the key properties of (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate?
(6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate has a molecular weight of 381.41 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) 4-[3-(4-fluorophenyl)-1,2,4-triazol-1-yl]piperidine-1-carboxylate is sourced from PubChem (CID 58270794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).