C19H24FN3O2 — CID 58270879
tert-butyl 4-[2-(2-fluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate (PubChem CID 58270879) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58270879 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl 4-[2-(2-fluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2=NC(c3ccccc3F)=NC2)CC1 |
| InChI | InChI=1S/C19H24FN3O2/c1-19(2,3)25-18(24)23-10-8-13(9-11-23)16-12-21-17(22-16)14-6-4-5-7-15(14)20/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | KFZGARJXKYLMKQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |