About 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one
1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one (PubChem CID 58270956) has the molecular formula C25H28F3NO
and a molecular weight of 415.50 g/mol. Its IUPAC name is 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one.
Molecular Properties
| Compound Name | 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one |
| PubChem CID | 58270956 |
| Molecular Formula | C25H28F3NO |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one |
| SMILES | Cc1cc2c(ccn2Cc2ccc(C(F)(F)F)cc2)c(C)c1CC(=O)CC(C)(C)C |
| InChI | InChI=1S/C25H28F3NO/c1-16-12-23-21(17(2)22(16)13-20(30)14-24(3,4)5)10-11-29(23)15-18-6-8-19(9-7-18)25(26,27)28/h6-12H,13-15H2,1-5H3 |
| InChIKey | BUQVAQQRDCYAOO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one?
The IUPAC name of 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one (CID 58270956) is 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one.
What is the SMILES notation for 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one?
The canonical SMILES for 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one is Cc1cc2c(ccn2Cc2ccc(C(F)(F)F)cc2)c(C)c1CC(=O)CC(C)(C)C.
What is the InChIKey of 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one?
The InChIKey is BUQVAQQRDCYAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28F3NO/c1-16-12-23-21(17(2)22(16)13-20(30)14-24(3,4)5)10-11-29(23)15-18-6-8-19(9-7-18)25(26,27)28/h6-12H,13-15H2,1-5H3.
What are the key properties of 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one?
1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one has a molecular weight of 415.50 g/mol, XLogP of 6.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]-4,4-dimethylpentan-2-one is sourced from PubChem (CID 58270956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).