C9H16O2 — CID 58271297
4-methyl-1,3,3a,4,5,7,8,8a-octahydrofuro[3,4-d]oxepine (PubChem CID 58271297) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 4-methyl-1,3,3a,4,5,7,8,8a-octahydrofuro[3,4-d]oxepine.
| Compound Name | 4-methyl-1,3,3a,4,5,7,8,8a-octahydrofuro[3,4-d]oxepine |
|---|---|
| PubChem CID | 58271297 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 4-methyl-1,3,3a,4,5,7,8,8a-octahydrofuro[3,4-d]oxepine |
| SMILES | CC1COCCC2COCC12 |
| InChI | InChI=1S/C9H16O2/c1-7-4-10-3-2-8-5-11-6-9(7)8/h7-9H,2-6H2,1H3 |
| InChIKey | NSCPPONAKXQBRG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |