C19H40N3O3+ — CID 58271441
3-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium (PubChem CID 58271441) has the molecular formula C19H40N3O3+ and a molecular weight of 358.55 g/mol. Its IUPAC name is 3-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58271441 |
| Molecular Formula | C19H40N3O3+ |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 3-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCC[N+](C)(C)C)C(=O)NCC(C)O |
| InChI | InChI=1S/C19H39N3O3/c1-9-19(5,17(25)21-13-15(2)23)14-18(3,4)16(24)20-11-10-12-22(6,7)8/h15,23H,9-14H2,1-8H3,(H-,20,21,24,25)/p+1 |
| InChIKey | UFZMPSJJJDYVKC-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|