C34H56N4O2 — CID 58271663
11,23-ditert-butyl-5,5,17,17-tetramethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),9,11,13(26),21(25),22-hexaene-25,26-diol (PubChem CID 58271663) has the molecular formula C34H56N4O2 and a molecular weight of 552.85 g/mol. Its IUPAC name is 11,23-ditert-butyl-5,5,17,17-tetramethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),9,11,13(26),21(25),22-hexaene-25,26-diol.
| Compound Name | 11,23-ditert-butyl-5,5,17,17-tetramethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),9,11,13(26),21(25),22-hexaene-25,26-diol |
|---|---|
| PubChem CID | 58271663 |
| Molecular Formula | C34H56N4O2 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | 11,23-ditert-butyl-5,5,17,17-tetramethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),9,11,13(26),21(25),22-hexaene-25,26-diol |
| SMILES | CC1(C)CNCc2cc(C(C)(C)C)cc(c2O)CNCC(C)(C)CNCc2cc(C(C)(C)C)cc(c2O)CNC1 |
| InChI | InChI=1S/C34H56N4O2/c1-31(2,3)27-11-23-15-35-19-33(7,8)21-37-17-25-13-28(32(4,5)6)14-26(30(25)40)18-38-22-34(9,10)20-36-16-24(12-27)29(23)39/h11-14,35-40H,15-22H2,1-10H3 |
| InChIKey | NPYIWQBVGZTXKK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|