C30H32N6O4 — CID 58271989
3,11,18,26,33,36-hexazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,20,22,24(33),28(32),29-nonaene-4,10,19,25-tetrone (PubChem CID 58271989) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3,11,18,26,33,36-hexazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,20,22,24(33),28(32),29-nonaene-4,10,19,25-tetrone.
| Compound Name | 3,11,18,26,33,36-hexazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,20,22,24(33),28(32),29-nonaene-4,10,19,25-tetrone |
|---|---|
| PubChem CID | 58271989 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 3,11,18,26,33,36-hexazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,20,22,24(33),28(32),29-nonaene-4,10,19,25-tetrone |
| SMILES | O=C1NCc2ccc(cc2)CNC(=O)c2cccc(n2)C(=O)NCC2CCC(CC2)CNC(=O)c2cccc1n2 |
| InChI | InChI=1S/C30H32N6O4/c37-27-23-3-1-4-24(35-23)28(38)32-16-20-9-13-22(14-10-20)18-34-30(40)26-6-2-5-25(36-26)29(39)33-17-21-11-7-19(8-12-21)15-31-27/h1-8,11-12,20,22H,9-10,13-18H2,(H,31,37)(H,32,38)(H,33,39)(H,34,40) |
| InChIKey | ZSVCYYJGBGFQGR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |