C29H27ClN2O5 — CID 58272154
4-[3-chloro-4-(2-oxopentyl)phenoxy]-N-methoxy-7-phenylmethoxyquinoline-6-carboxamide (PubChem CID 58272154) has the molecular formula C29H27ClN2O5 and a molecular weight of 519.00 g/mol. Its IUPAC name is 4-[3-chloro-4-(2-oxopentyl)phenoxy]-N-methoxy-7-phenylmethoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(2-oxopentyl)phenoxy]-N-methoxy-7-phenylmethoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58272154 |
| Molecular Formula | C29H27ClN2O5 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-[3-chloro-4-(2-oxopentyl)phenoxy]-N-methoxy-7-phenylmethoxyquinoline-6-carboxamide |
| SMILES | CCCC(=O)Cc1ccc(Oc2ccnc3cc(OCc4ccccc4)c(C(=O)NOC)cc23)cc1Cl |
| InChI | InChI=1S/C29H27ClN2O5/c1-3-7-21(33)14-20-10-11-22(15-25(20)30)37-27-12-13-31-26-17-28(36-18-19-8-5-4-6-9-19)24(16-23(26)27)29(34)32-35-2/h4-6,8-13,15-17H,3,7,14,18H2,1-2H3,(H,32,34) |
| InChIKey | HVDAAPIUUCALDG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|