About phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate
phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate (PubChem CID 58272597) has the molecular formula C27H24N2O4
and a molecular weight of 440.50 g/mol. Its IUPAC name is phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate.
Molecular Properties
| Compound Name | phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate |
| PubChem CID | 58272597 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate |
| SMILES | Cc1cc(Oc2ccnc3cc(C)c(C(N)=O)cc23)c(C)cc1CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C27H24N2O4/c1-16-13-25(18(3)11-19(16)14-26(30)32-20-7-5-4-6-8-20)33-24-9-10-29-23-12-17(2)21(27(28)31)15-22(23)24/h4-13,15H,14H2,1-3H3,(H2,28,31) |
| InChIKey | GSXJYUMGZVZINL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate?
The IUPAC name of phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate (CID 58272597) is phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate.
What is the SMILES notation for phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate?
The canonical SMILES for phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate is Cc1cc(Oc2ccnc3cc(C)c(C(N)=O)cc23)c(C)cc1CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate?
The InChIKey is GSXJYUMGZVZINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O4/c1-16-13-25(18(3)11-19(16)14-26(30)32-20-7-5-4-6-8-20)33-24-9-10-29-23-12-17(2)21(27(28)31)15-22(23)24/h4-13,15H,14H2,1-3H3,(H2,28,31).
What are the key properties of phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate?
phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate has a molecular weight of 440.50 g/mol, XLogP of 5.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-[4-(6-carbamoyl-7-methylquinolin-4-yl)oxy-2,5-dimethylphenyl]acetate is sourced from PubChem (CID 58272597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).